C14H23ClFN5 — CID 106194210
2-chloro-5-fluoro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]pyrimidin-4-amine (PubChem CID 106194210) has the molecular formula C14H23ClFN5 and a molecular weight of 315.82 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-fluoro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106194210 |
| Molecular Formula | C14H23ClFN5 |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-chloro-5-fluoro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]pyrimidin-4-amine |
| SMILES | CC(C)C(CNc1nc(Cl)ncc1F)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H23ClFN5/c1-10(2)12(21-6-4-20(3)5-7-21)9-17-13-11(16)8-18-14(15)19-13/h8,10,12H,4-7,9H2,1-3H3,(H,17,18,19) |
| InChIKey | BSDSNMBKELFQHC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |