C13H12BrClFN3 — CID 106194274
N-[(5-bromo-2-fluorophenyl)methyl]-6-chloro-5-ethylpyrimidin-4-amine (PubChem CID 106194274) has the molecular formula C13H12BrClFN3 and a molecular weight of 344.62 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-6-chloro-5-ethylpyrimidin-4-amine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-6-chloro-5-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106194274 |
| Molecular Formula | C13H12BrClFN3 |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-6-chloro-5-ethylpyrimidin-4-amine |
| SMILES | CCc1c(Cl)ncnc1NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H12BrClFN3/c1-2-10-12(15)18-7-19-13(10)17-6-8-5-9(14)3-4-11(8)16/h3-5,7H,2,6H2,1H3,(H,17,18,19) |
| InChIKey | GPOBVKWPBZUKKW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |