C13H16N4 — CID 106194333
4-[3-(3-methylbut-2-enyl)imidazol-4-yl]pyridin-2-amine (PubChem CID 106194333) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 4-[3-(3-methylbut-2-enyl)imidazol-4-yl]pyridin-2-amine.
| Compound Name | 4-[3-(3-methylbut-2-enyl)imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 106194333 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-[3-(3-methylbut-2-enyl)imidazol-4-yl]pyridin-2-amine |
| SMILES | CC(C)=CCn1cncc1-c1ccnc(N)c1 |
| InChI | InChI=1S/C13H16N4/c1-10(2)4-6-17-9-15-8-12(17)11-3-5-16-13(14)7-11/h3-5,7-9H,6H2,1-2H3,(H2,14,16) |
| InChIKey | AFKBGXLCYRMVRL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|