C8H7ClFN5 — CID 106194384
2-chloro-5-fluoro-N-(1H-pyrazol-5-ylmethyl)pyrimidin-4-amine (PubChem CID 106194384) has the molecular formula C8H7ClFN5 and a molecular weight of 227.63 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-(1H-pyrazol-5-ylmethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-5-fluoro-N-(1H-pyrazol-5-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106194384 |
| Molecular Formula | C8H7ClFN5 |
| Molecular Weight | 227.63 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-chloro-5-fluoro-N-(1H-pyrazol-5-ylmethyl)pyrimidin-4-amine |
| SMILES | Fc1cnc(Cl)nc1NCc1ccn[nH]1 |
| InChI | InChI=1S/C8H7ClFN5/c9-8-12-4-6(10)7(14-8)11-3-5-1-2-13-15-5/h1-2,4H,3H2,(H,13,15)(H,11,12,14) |
| InChIKey | NADQENPRNLWPBI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.63 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |