C23H24N2O3 — CID 10619541
(1S,2S,10R,18R)-19-(cyclopropylmethyl)-11-oxa-8,19-diazahexacyclo[10.9.1.01,10.02,18.04,9.016,22]docosa-4(9),5,7,12,14,16(22)-hexaene-2,13-diol (PubChem CID 10619541) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (1S,2S,10R,18R)-19-(cyclopropylmethyl)-11-oxa-8,19-diazahexacyclo[10.9.1.01,10.02,18.04,9.016,22]docosa-4(9),5,7,12,14,16(22)-hexaene-2,13-diol.
| Compound Name | (1S,2S,10R,18R)-19-(cyclopropylmethyl)-11-oxa-8,19-diazahexacyclo[10.9.1.01,10.02,18.04,9.016,22]docosa-4(9),5,7,12,14,16(22)-hexaene-2,13-diol |
|---|---|
| PubChem CID | 10619541 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (1S,2S,10R,18R)-19-(cyclopropylmethyl)-11-oxa-8,19-diazahexacyclo[10.9.1.01,10.02,18.04,9.016,22]docosa-4(9),5,7,12,14,16(22)-hexaene-2,13-diol |
| SMILES | Oc1ccc2c3c1O[C@H]1c4ncccc4C[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C23H24N2O3/c26-16-6-5-14-10-17-23(27)11-15-2-1-8-24-19(15)21-22(23,18(14)20(16)28-21)7-9-25(17)12-13-3-4-13/h1-2,5-6,8,13,17,21,26-27H,3-4,7,9-12H2/t17-,21+,22+,23-/m1/s1 |
| InChIKey | UUKFYSADJMUSTK-LMDOGRNLSA-N |
| XLogP | 2.49 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |