C11H14ClN3 — CID 106195802
N-but-2-ynyl-6-chloro-5-propan-2-ylpyrimidin-4-amine (PubChem CID 106195802) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is N-but-2-ynyl-6-chloro-5-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-but-2-ynyl-6-chloro-5-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106195802 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-but-2-ynyl-6-chloro-5-propan-2-ylpyrimidin-4-amine |
| SMILES | CC#CCNc1ncnc(Cl)c1C(C)C |
| InChI | InChI=1S/C11H14ClN3/c1-4-5-6-13-11-9(8(2)3)10(12)14-7-15-11/h7-8H,6H2,1-3H3,(H,13,14,15) |
| InChIKey | YZWBKGKLWQGVJS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|