C10H12ClN7 — CID 106195902
4-chloro-N-[(E)-pent-3-enyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 106195902) has the molecular formula C10H12ClN7 and a molecular weight of 265.71 g/mol. Its IUPAC name is 4-chloro-N-[(E)-pent-3-enyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-[(E)-pent-3-enyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106195902 |
| Molecular Formula | C10H12ClN7 |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 4-chloro-N-[(E)-pent-3-enyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | C/C=C/CCNc1nc(Cl)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H12ClN7/c1-2-3-4-5-13-9-15-8(11)16-10(17-9)18-7-12-6-14-18/h2-3,6-7H,4-5H2,1H3,(H,13,15,16,17)/b3-2+ |
| InChIKey | FXCXNHANOBRGCL-NSCUHMNNSA-N |
| XLogP | 1.48 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|