C12H20ClN5 — CID 106195909
6-chloro-2-N,2-N-diethyl-4-N-[(E)-pent-3-enyl]-1,3,5-triazine-2,4-diamine (PubChem CID 106195909) has the molecular formula C12H20ClN5 and a molecular weight of 269.78 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-diethyl-4-N-[(E)-pent-3-enyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N-diethyl-4-N-[(E)-pent-3-enyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 106195909 |
| Molecular Formula | C12H20ClN5 |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 6-chloro-2-N,2-N-diethyl-4-N-[(E)-pent-3-enyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C/C=C/CCNc1nc(Cl)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C12H20ClN5/c1-4-7-8-9-14-11-15-10(13)16-12(17-11)18(5-2)6-3/h4,7H,5-6,8-9H2,1-3H3,(H,14,15,16,17)/b7-4+ |
| InChIKey | RTEPGOCWCYLZTI-QPJJXVBHSA-N |
| XLogP | 2.75 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|