C21H23N5O2 — CID 10619606
(E)-6-[3-[[(cyanoamino)-(dimethylamino)methylidene]amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 10619606) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is (E)-6-[3-[[(cyanoamino)-(dimethylamino)methylidene]amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | (E)-6-[3-[[(cyanoamino)-(dimethylamino)methylidene]amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 10619606 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (E)-6-[3-[[(cyanoamino)-(dimethylamino)methylidene]amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | CN(C)/C(=N\c1cccc(/C(=C\CCCC(=O)O)c2cccnc2)c1)NC#N |
| InChI | InChI=1S/C21H23N5O2/c1-26(2)21(24-15-22)25-18-9-5-7-16(13-18)19(10-3-4-11-20(27)28)17-8-6-12-23-14-17/h5-10,12-14H,3-4,11H2,1-2H3,(H,24,25)(H,27,28)/b19-10+ |
| InChIKey | UEBOELMCZQDCEI-VXLYETTFSA-N |
| XLogP | 3.39 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|