About triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane
triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane (PubChem CID 10619683) has the molecular formula C22H42OSi2
and a molecular weight of 378.75 g/mol. Its IUPAC name is triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane.
Molecular Properties
| Compound Name | triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane |
| PubChem CID | 10619683 |
| Molecular Formula | C22H42OSi2 |
| Molecular Weight | 378.75 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane |
| SMILES | C=CCCCC(C#C[Si](C)(C)C)(CCCC=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H42OSi2/c1-9-14-16-18-22(19-17-15-10-2,20-21-24(6,7)8)23-25(11-3,12-4)13-5/h9-10H,1-2,11-19H2,3-8H3 |
| InChIKey | RCVWBXHONRVFSJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.75 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane?
The IUPAC name of triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane (CID 10619683) is triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane.
What is the SMILES notation for triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane?
The canonical SMILES for triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane is C=CCCCC(C#C[Si](C)(C)C)(CCCC=C)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane?
The InChIKey is RCVWBXHONRVFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42OSi2/c1-9-14-16-18-22(19-17-15-10-2,20-21-24(6,7)8)23-25(11-3,12-4)13-5/h9-10H,1-2,11-19H2,3-8H3.
What are the key properties of triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane?
triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane has a molecular weight of 378.75 g/mol, XLogP of 7.34, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-yloxy]silane is sourced from PubChem (CID 10619683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).