C12H11ClN4O2 — CID 106196938
6-chloro-N-[(2-methyl-3-nitrophenyl)methyl]pyrimidin-4-amine (PubChem CID 106196938) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 6-chloro-N-[(2-methyl-3-nitrophenyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(2-methyl-3-nitrophenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106196938 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 6-chloro-N-[(2-methyl-3-nitrophenyl)methyl]pyrimidin-4-amine |
| SMILES | Cc1c(CNc2cc(Cl)ncn2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11ClN4O2/c1-8-9(3-2-4-10(8)17(18)19)6-14-12-5-11(13)15-7-16-12/h2-5,7H,6H2,1H3,(H,14,15,16) |
| InChIKey | WZIFGVOOOGYWMD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|