About 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine
6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine (PubChem CID 106197156) has the molecular formula C10H16ClN3O2
and a molecular weight of 245.71 g/mol. Its IUPAC name is 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine |
| PubChem CID | 106197156 |
| Molecular Formula | C10H16ClN3O2 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine |
| SMILES | COC(CNc1nc(C)nc(Cl)c1C)OC |
| InChI | InChI=1S/C10H16ClN3O2/c1-6-9(11)13-7(2)14-10(6)12-5-8(15-3)16-4/h8H,5H2,1-4H3,(H,12,13,14) |
| InChIKey | VAATVDRZMWOEOX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine?
The IUPAC name of 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine (CID 106197156) is 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine.
What is the SMILES notation for 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine?
The canonical SMILES for 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine is COC(CNc1nc(C)nc(Cl)c1C)OC.
What is the InChIKey of 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine?
The InChIKey is VAATVDRZMWOEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3O2/c1-6-9(11)13-7(2)14-10(6)12-5-8(15-3)16-4/h8H,5H2,1-4H3,(H,12,13,14).
What are the key properties of 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine?
6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine has a molecular weight of 245.71 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2,2-dimethoxyethyl)-2,5-dimethylpyrimidin-4-amine is sourced from PubChem (CID 106197156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).