C11H14ClN5 — CID 106197254
5-chloro-6-methyl-N-(3-methylbut-2-enyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 106197254) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is 5-chloro-6-methyl-N-(3-methylbut-2-enyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-methyl-N-(3-methylbut-2-enyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 106197254 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-chloro-6-methyl-N-(3-methylbut-2-enyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(C)=CCNc1c(C)c(Cl)nc2ncnn12 |
| InChI | InChI=1S/C11H14ClN5/c1-7(2)4-5-13-10-8(3)9(12)16-11-14-6-15-17(10)11/h4,6,13H,5H2,1-3H3 |
| InChIKey | OLGVUZZFYOKOSU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|