C21H37NO3Si — CID 10619732
(2R)-4-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylbutanamide (PubChem CID 10619732) has the molecular formula C21H37NO3Si and a molecular weight of 379.62 g/mol. Its IUPAC name is (2R)-4-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylbutanamide.
| Compound Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 10619732 |
| Molecular Formula | C21H37NO3Si |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylbutanamide |
| SMILES | C[C@H](CCO[Si](C)(C)C(C)(C)C)C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H37NO3Si/c1-16(14-15-25-26(7,8)21(3,4)5)20(24)22(6)17(2)19(23)18-12-10-9-11-13-18/h9-13,16-17,19,23H,14-15H2,1-8H3/t16-,17+,19-/m1/s1 |
| InChIKey | OTBYLFPZSPQDBL-ZIFCJYIRSA-N |
| XLogP | 4.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|