C13H21N2O9P — CID 10619741
[(2R,3S,4R,5R)-5-(5-butyl-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 10619741) has the molecular formula C13H21N2O9P and a molecular weight of 380.29 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(5-butyl-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(5-butyl-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10619741 |
| Molecular Formula | C13H21N2O9P |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(5-butyl-2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | CCCCc1cn([C@@H]2O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21N2O9P/c1-2-3-4-7-5-15(13(19)14-11(7)18)12-9(17)10(8(6-16)23-12)24-25(20,21)22/h5,8-10,12,16-17H,2-4,6H2,1H3,(H,14,18,19)(H2,20,21,22)/t8-,9-,10-,12-/m1/s1 |
| InChIKey | PZQIYUJVWOMECU-DNRKLUKYSA-N |
| XLogP | -1.39 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|