C19H16N4O3S — CID 10619757
2,6-bis(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxothioxanthen-9-one (PubChem CID 10619757) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2,6-bis(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxothioxanthen-9-one.
| Compound Name | 2,6-bis(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxothioxanthen-9-one |
|---|---|
| PubChem CID | 10619757 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2,6-bis(4,5-dihydro-1H-imidazol-2-yl)-10,10-dioxothioxanthen-9-one |
| SMILES | O=C1c2cc(C3=NCCN3)ccc2S(=O)(=O)c2cc(C3=NCCN3)ccc21 |
| InChI | InChI=1S/C19H16N4O3S/c24-17-13-3-1-12(19-22-7-8-23-19)10-16(13)27(25,26)15-4-2-11(9-14(15)17)18-20-5-6-21-18/h1-4,9-10H,5-8H2,(H,20,21)(H,22,23) |
| InChIKey | QKVCNHDDCWYTBK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |