About bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol
bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol (PubChem CID 10619795) has the molecular formula C18H20O3S3
and a molecular weight of 380.56 g/mol. Its IUPAC name is bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol.
Molecular Properties
| Compound Name | bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol |
| PubChem CID | 10619795 |
| Molecular Formula | C18H20O3S3 |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)C2SCSCS2)cc1 |
| InChI | InChI=1S/C18H20O3S3/c1-20-15-7-3-13(4-8-15)18(19,17-23-11-22-12-24-17)14-5-9-16(21-2)10-6-14/h3-10,17,19H,11-12H2,1-2H3 |
| InChIKey | ZXXRQCRMILNGBZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol?
The IUPAC name of bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol (CID 10619795) is bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol.
What is the SMILES notation for bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol?
The canonical SMILES for bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol is COc1ccc(C(O)(c2ccc(OC)cc2)C2SCSCS2)cc1.
What is the InChIKey of bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol?
The InChIKey is ZXXRQCRMILNGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3S3/c1-20-15-7-3-13(4-8-15)18(19,17-23-11-22-12-24-17)14-5-9-16(21-2)10-6-14/h3-10,17,19H,11-12H2,1-2H3.
What are the key properties of bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol?
bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol has a molecular weight of 380.56 g/mol, XLogP of 4.39, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methoxyphenyl)-(1,3,5-trithian-2-yl)methanol is sourced from PubChem (CID 10619795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).