C10H13N9O — CID 106198852
4-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]pyrrolidin-2-one (PubChem CID 106198852) has the molecular formula C10H13N9O and a molecular weight of 275.28 g/mol. Its IUPAC name is 4-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106198852 |
| Molecular Formula | C10H13N9O |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-[(4-hydrazinyl-6-imidazol-1-yl-1,3,5-triazin-2-yl)amino]pyrrolidin-2-one |
| SMILES | NNc1nc(NC2CNC(=O)C2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C10H13N9O/c11-18-9-15-8(14-6-3-7(20)13-4-6)16-10(17-9)19-2-1-12-5-19/h1-2,5-6H,3-4,11H2,(H,13,20)(H2,14,15,16,17,18) |
| InChIKey | JMMRWIRFXPWLOD-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 135.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|