About 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one
4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one (PubChem CID 106198866) has the molecular formula C10H12N6OS
and a molecular weight of 264.31 g/mol. Its IUPAC name is 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one |
| PubChem CID | 106198866 |
| Molecular Formula | C10H12N6OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one |
| SMILES | NNc1nc(NC2CNC(=O)C2)c2ccsc2n1 |
| InChI | InChI=1S/C10H12N6OS/c11-16-10-14-8(6-1-2-18-9(6)15-10)13-5-3-7(17)12-4-5/h1-2,5H,3-4,11H2,(H,12,17)(H2,13,14,15,16) |
| InChIKey | WAQRWNFUWRDMSK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one?
The IUPAC name of 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one (CID 106198866) is 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one.
What is the SMILES notation for 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one?
The canonical SMILES for 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one is NNc1nc(NC2CNC(=O)C2)c2ccsc2n1.
What is the InChIKey of 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one?
The InChIKey is WAQRWNFUWRDMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N6OS/c11-16-10-14-8(6-1-2-18-9(6)15-10)13-5-3-7(17)12-4-5/h1-2,5H,3-4,11H2,(H,12,17)(H2,13,14,15,16).
What are the key properties of 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one?
4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one has a molecular weight of 264.31 g/mol, XLogP of 0.28, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]pyrrolidin-2-one is sourced from PubChem (CID 106198866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).