C21H38O4Si — CID 10619944
3-[(1'S,3'aS,4'S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]propanal (PubChem CID 10619944) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is 3-[(1'S,3'aS,4'S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]propanal.
| Compound Name | 3-[(1'S,3'aS,4'S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]propanal |
|---|---|
| PubChem CID | 10619944 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 3-[(1'S,3'aS,4'S,7'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-4'-yl]propanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@H](CCC=O)C3(CC[C@]12C)OCCO3 |
| InChI | InChI=1S/C21H38O4Si/c1-19(2,3)26(5,6)25-18-10-9-16-17(8-7-13-22)21(23-14-15-24-21)12-11-20(16,18)4/h13,16-18H,7-12,14-15H2,1-6H3/t16-,17-,18-,20-/m0/s1 |
| InChIKey | ACGWPRYPHMDYJF-JPLJXNOCSA-N |
| XLogP | 4.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|