C22H42O3Si — CID 10619947
[(1S)-1-[(4R,5S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-yl]but-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 10619947) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is [(1S)-1-[(4R,5S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-yl]but-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1S)-1-[(4R,5S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-yl]but-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10619947 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | [(1S)-1-[(4R,5S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-yl]but-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | C=CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1COC(C)(C)O[C@@H]1CC=C |
| InChI | InChI=1S/C22H42O3Si/c1-11-13-20-19(15-23-22(9,10)24-20)21(14-12-2)25-26(16(3)4,17(5)6)18(7)8/h11-12,16-21H,1-2,13-15H2,3-10H3/t19-,20+,21-/m0/s1 |
| InChIKey | URVSDWYVZOCVRG-HBMCJLEFSA-N |
| XLogP | 6.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|