C10H17N3O — CID 106200002
1-[2-(2-cyclopropylethoxy)ethyl]pyrazol-3-amine (PubChem CID 106200002) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-[2-(2-cyclopropylethoxy)ethyl]pyrazol-3-amine.
| Compound Name | 1-[2-(2-cyclopropylethoxy)ethyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 106200002 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-[2-(2-cyclopropylethoxy)ethyl]pyrazol-3-amine |
| SMILES | Nc1ccn(CCOCCC2CC2)n1 |
| InChI | InChI=1S/C10H17N3O/c11-10-3-5-13(12-10)6-8-14-7-4-9-1-2-9/h3,5,9H,1-2,4,6-8H2,(H2,11,12) |
| InChIKey | BOCYPHCDNIDGOW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|