C12H10Cl4N4O2 — CID 10620012
4,5-dichloro-2-[4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl]pyridazin-3-one (PubChem CID 10620012) has the molecular formula C12H10Cl4N4O2 and a molecular weight of 384.05 g/mol. Its IUPAC name is 4,5-dichloro-2-[4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl]pyridazin-3-one |
|---|---|
| PubChem CID | 10620012 |
| Molecular Formula | C12H10Cl4N4O2 |
| Molecular Weight | 384.05 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 4,5-dichloro-2-[4-(4,5-dichloro-6-oxopyridazin-1-yl)butyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCCCn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C12H10Cl4N4O2/c13-7-5-17-19(11(21)9(7)15)3-1-2-4-20-12(22)10(16)8(14)6-18-20/h5-6H,1-4H2 |
| InChIKey | ZSKANCJKWZGJFD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.05 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|