About 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine
2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine (PubChem CID 10620060) has the molecular formula C23H33FN4
and a molecular weight of 384.54 g/mol. Its IUPAC name is 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine.
Molecular Properties
| Compound Name | 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine |
| PubChem CID | 10620060 |
| Molecular Formula | C23H33FN4 |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine |
| SMILES | CCN(c1nc(F)ccc1NC(C)(C)C)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H33FN4/c1-5-28(22-20(26-23(2,3)4)11-12-21(24)25-22)19-13-15-27(16-14-19)17-18-9-7-6-8-10-18/h6-12,19,26H,5,13-17H2,1-4H3 |
| InChIKey | QTTXLQMFKKLABR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine?
The IUPAC name of 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine (CID 10620060) is 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine.
What is the SMILES notation for 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine?
The canonical SMILES for 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine is CCN(c1nc(F)ccc1NC(C)(C)C)C1CCN(Cc2ccccc2)CC1.
What is the InChIKey of 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine?
The InChIKey is QTTXLQMFKKLABR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33FN4/c1-5-28(22-20(26-23(2,3)4)11-12-21(24)25-22)19-13-15-27(16-14-19)17-18-9-7-6-8-10-18/h6-12,19,26H,5,13-17H2,1-4H3.
What are the key properties of 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine?
2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine has a molecular weight of 384.54 g/mol, XLogP of 4.92, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(1-benzylpiperidin-4-yl)-3-N-tert-butyl-2-N-ethyl-6-fluoropyridine-2,3-diamine is sourced from PubChem (CID 10620060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).