C24H36N2O2 — CID 10620066
(2S,5S)-5-(hydroxymethyl)-1-methyl-2-propan-2-ylspiro[4,5,6,8,9,10-hexahydro-2H-benzo[i][1,4]benzodiazocine-11,1'-cyclohexane]-3-one (PubChem CID 10620066) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is (2S,5S)-5-(hydroxymethyl)-1-methyl-2-propan-2-ylspiro[4,5,6,8,9,10-hexahydro-2H-benzo[i][1,4]benzodiazocine-11,1'-cyclohexane]-3-one.
| Compound Name | (2S,5S)-5-(hydroxymethyl)-1-methyl-2-propan-2-ylspiro[4,5,6,8,9,10-hexahydro-2H-benzo[i][1,4]benzodiazocine-11,1'-cyclohexane]-3-one |
|---|---|
| PubChem CID | 10620066 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | (2S,5S)-5-(hydroxymethyl)-1-methyl-2-propan-2-ylspiro[4,5,6,8,9,10-hexahydro-2H-benzo[i][1,4]benzodiazocine-11,1'-cyclohexane]-3-one |
| SMILES | CC(C)[C@H]1C(=O)N[C@H](CO)Cc2cc3c(cc2N1C)C1(CCCCC1)CCC3 |
| InChI | InChI=1S/C24H36N2O2/c1-16(2)22-23(28)25-19(15-27)13-18-12-17-8-7-11-24(9-5-4-6-10-24)20(17)14-21(18)26(22)3/h12,14,16,19,22,27H,4-11,13,15H2,1-3H3,(H,25,28)/t19-,22-/m0/s1 |
| InChIKey | AUKKJONMOORTGO-UGKGYDQZSA-N |
| XLogP | 3.72 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |