C10H13N3OS — CID 106201688
3-(2-cyclopropylethoxy)pyridazine-4-carbothioamide (PubChem CID 106201688) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-(2-cyclopropylethoxy)pyridazine-4-carbothioamide.
| Compound Name | 3-(2-cyclopropylethoxy)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 106201688 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-(2-cyclopropylethoxy)pyridazine-4-carbothioamide |
| SMILES | NC(=S)c1ccnnc1OCCC1CC1 |
| InChI | InChI=1S/C10H13N3OS/c11-9(15)8-3-5-12-13-10(8)14-6-4-7-1-2-7/h3,5,7H,1-2,4,6H2,(H2,11,15) |
| InChIKey | SDEAWDAHWRMQDX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|