C23H31FN2O2 — CID 10620194
8-[4-[[(2R)-5-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 10620194) has the molecular formula C23H31FN2O2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 8-[4-[[(2R)-5-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]butyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[4-[[(2R)-5-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]butyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 10620194 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 8-[4-[[(2R)-5-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino]butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCCCN[C@@H]1CCc2c(F)cccc2C1 |
| InChI | InChI=1S/C23H31FN2O2/c24-20-7-5-6-17-14-18(8-9-19(17)20)25-12-3-4-13-26-21(27)15-23(16-22(26)28)10-1-2-11-23/h5-7,18,25H,1-4,8-16H2/t18-/m1/s1 |
| InChIKey | GVWRDZDVMQQZBK-GOSISDBHSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|