C14H19ClN2O — CID 106202147
3-chloro-4-(2-cyclobutylethoxymethyl)benzenecarboximidamide (PubChem CID 106202147) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 3-chloro-4-(2-cyclobutylethoxymethyl)benzenecarboximidamide.
| Compound Name | 3-chloro-4-(2-cyclobutylethoxymethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 106202147 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-chloro-4-(2-cyclobutylethoxymethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(COCCC2CCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O/c15-13-8-11(14(16)17)4-5-12(13)9-18-7-6-10-2-1-3-10/h4-5,8,10H,1-3,6-7,9H2,(H3,16,17) |
| InChIKey | CQKXFJNDNJXUQZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|