About 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate
2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate (PubChem CID 106202899) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 106202899 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(OCCC1CCC1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H19NO2/c13-11(10-5-2-7-12-10)14-8-6-9-3-1-4-9/h9-10,12H,1-8H2/t10-/m0/s1 |
| InChIKey | UJRJFNQDENVJQR-JTQLQIEISA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate (CID 106202899) is 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate is O=C(OCCC1CCC1)[C@@H]1CCCN1.
What is the InChIKey of 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate?
The InChIKey is UJRJFNQDENVJQR-JTQLQIEISA-N. The full InChI is InChI=1S/C11H19NO2/c13-11(10-5-2-7-12-10)14-8-6-9-3-1-4-9/h9-10,12H,1-8H2/t10-/m0/s1.
What are the key properties of 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate?
2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate has a molecular weight of 197.28 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylethyl (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 106202899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).