C21H19N5O3 — CID 10620372
N-[(E)-[2-(4-methoxyphenoxy)-1-(pyridin-3-ylmethylideneamino)ethylidene]amino]pyridine-4-carboxamide (PubChem CID 10620372) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is N-[(E)-[2-(4-methoxyphenoxy)-1-(pyridin-3-ylmethylideneamino)ethylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[2-(4-methoxyphenoxy)-1-(pyridin-3-ylmethylideneamino)ethylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10620372 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[(E)-[2-(4-methoxyphenoxy)-1-(pyridin-3-ylmethylideneamino)ethylidene]amino]pyridine-4-carboxamide |
| SMILES | COc1ccc(OCC(/N=C/c2cccnc2)=N\NC(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C21H19N5O3/c1-28-18-4-6-19(7-5-18)29-15-20(24-14-16-3-2-10-23-13-16)25-26-21(27)17-8-11-22-12-9-17/h2-14H,15H2,1H3,(H,26,27)/b24-14+,25-20+ |
| InChIKey | PWVWHXBEWXVPTO-JYPYDPOKSA-N |
| XLogP | 2.73 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|