C23H22N2O4 — CID 10620419
2-[[4-(1-hydroxyethyl)benzoyl]amino]-N-(4-methoxyphenyl)benzamide (PubChem CID 10620419) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[[4-(1-hydroxyethyl)benzoyl]amino]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 2-[[4-(1-hydroxyethyl)benzoyl]amino]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 10620419 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[[4-(1-hydroxyethyl)benzoyl]amino]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(C(C)O)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-15(26)16-7-9-17(10-8-16)22(27)25-21-6-4-3-5-20(21)23(28)24-18-11-13-19(29-2)14-12-18/h3-15,26H,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | QDZKFVOGGMEKES-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |