C23H27N3O3 — CID 10620594
11-(6-morpholin-4-ylhexanoyl)-5H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 10620594) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 11-(6-morpholin-4-ylhexanoyl)-5H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 11-(6-morpholin-4-ylhexanoyl)-5H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 10620594 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 11-(6-morpholin-4-ylhexanoyl)-5H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | O=C1Nc2ccccc2N(C(=O)CCCCCN2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C23H27N3O3/c27-22(12-2-1-7-13-25-14-16-29-17-15-25)26-20-10-5-3-8-18(20)23(28)24-19-9-4-6-11-21(19)26/h3-6,8-11H,1-2,7,12-17H2,(H,24,28) |
| InChIKey | JLHACYFVHZXMQJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|