C22H18N8 — CID 10620644
[2-[4-[3,6-bis(cyanoimino)-4-methylcyclohexa-1,4-dien-1-yl]butyl]-4-cyanoimino-5-methylcyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 10620644) has the molecular formula C22H18N8 and a molecular weight of 394.44 g/mol. Its IUPAC name is [2-[4-[3,6-bis(cyanoimino)-4-methylcyclohexa-1,4-dien-1-yl]butyl]-4-cyanoimino-5-methylcyclohexa-2,5-dien-1-ylidene]cyanamide.
| Compound Name | [2-[4-[3,6-bis(cyanoimino)-4-methylcyclohexa-1,4-dien-1-yl]butyl]-4-cyanoimino-5-methylcyclohexa-2,5-dien-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 10620644 |
| Molecular Formula | C22H18N8 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [2-[4-[3,6-bis(cyanoimino)-4-methylcyclohexa-1,4-dien-1-yl]butyl]-4-cyanoimino-5-methylcyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | CC1=C/C(=N\C#N)C(CCCCC2=C/C(=N\C#N)C(C)=C/C2=N\C#N)=C/C1=N/C#N |
| InChI | InChI=1S/C22H18N8/c1-15-7-21(29-13-25)17(9-19(15)27-11-23)5-3-4-6-18-10-20(28-12-24)16(2)8-22(18)30-14-26/h7-10H,3-6H2,1-2H3/b27-19-,28-20+,29-21+,30-22+ |
| InChIKey | IGJOLSQDQQLEIB-GTTAPVPCSA-N |
| XLogP | 4.01 |
| TPSA | 144.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|