About 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate
2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate (PubChem CID 106206631) has the molecular formula C12H13ClN2O4
and a molecular weight of 284.70 g/mol. Its IUPAC name is 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate.
Molecular Properties
| Compound Name | 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate |
| PubChem CID | 106206631 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate |
| SMILES | O=C(OCCC1CCC1)c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13ClN2O4/c13-11-6-9(10(7-14-11)15(17)18)12(16)19-5-4-8-2-1-3-8/h6-8H,1-5H2 |
| InChIKey | GHMKWQCMQDHJLC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate?
The IUPAC name of 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate (CID 106206631) is 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate.
What is the SMILES notation for 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate?
The canonical SMILES for 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate is O=C(OCCC1CCC1)c1cc(Cl)ncc1[N+](=O)[O-].
What is the InChIKey of 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate?
The InChIKey is GHMKWQCMQDHJLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O4/c13-11-6-9(10(7-14-11)15(17)18)12(16)19-5-4-8-2-1-3-8/h6-8H,1-5H2.
What are the key properties of 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate?
2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate has a molecular weight of 284.70 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylethyl 2-chloro-5-nitropyridine-4-carboxylate is sourced from PubChem (CID 106206631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).