C18H16Cl2N2O4 — CID 10620686
methyl 3-[2-[(3,4-dichlorophenyl)methyl]-1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl]propanoate (PubChem CID 10620686) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is methyl 3-[2-[(3,4-dichlorophenyl)methyl]-1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl]propanoate.
| Compound Name | methyl 3-[2-[(3,4-dichlorophenyl)methyl]-1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl]propanoate |
|---|---|
| PubChem CID | 10620686 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | methyl 3-[2-[(3,4-dichlorophenyl)methyl]-1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl]propanoate |
| SMILES | COC(=O)CCC1C(=O)N(Cc2ccc(Cl)c(Cl)c2)C(=O)c2cccn21 |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-26-16(23)7-6-15-18(25)22(17(24)14-3-2-8-21(14)15)10-11-4-5-12(19)13(20)9-11/h2-5,8-9,15H,6-7,10H2,1H3 |
| InChIKey | PXDVHTPVQATLDR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|