C25H37NOSi — CID 10620733
tert-butyl-dimethyl-[[(1S,3S)-1-(2,4,6-trimethylphenyl)-1,2,3,4-tetrahydroisoquinolin-3-yl]methoxy]silane (PubChem CID 10620733) has the molecular formula C25H37NOSi and a molecular weight of 395.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,3S)-1-(2,4,6-trimethylphenyl)-1,2,3,4-tetrahydroisoquinolin-3-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,3S)-1-(2,4,6-trimethylphenyl)-1,2,3,4-tetrahydroisoquinolin-3-yl]methoxy]silane |
|---|---|
| PubChem CID | 10620733 |
| Molecular Formula | C25H37NOSi |
| Molecular Weight | 395.66 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,3S)-1-(2,4,6-trimethylphenyl)-1,2,3,4-tetrahydroisoquinolin-3-yl]methoxy]silane |
| SMILES | Cc1cc(C)c([C@H]2N[C@H](CO[Si](C)(C)C(C)(C)C)Cc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C25H37NOSi/c1-17-13-18(2)23(19(3)14-17)24-22-12-10-9-11-20(22)15-21(26-24)16-27-28(7,8)25(4,5)6/h9-14,21,24,26H,15-16H2,1-8H3/t21-,24-/m0/s1 |
| InChIKey | XDCUNUMFRMQMSR-URXFXBBRSA-N |
| XLogP | 6.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|