About 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate
2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate (PubChem CID 106207980) has the molecular formula C11H15NO2S2
and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate.
Molecular Properties
| Compound Name | 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate |
| PubChem CID | 106207980 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)OCCC1CC1 |
| InChI | InChI=1S/C11H15NO2S2/c1-7-9(16-11(15)12-7)6-10(13)14-5-4-8-2-3-8/h8H,2-6H2,1H3,(H,12,15) |
| InChIKey | RERMFYVTJMLOPG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate?
The IUPAC name of 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate (CID 106207980) is 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate.
What is the SMILES notation for 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate?
The canonical SMILES for 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate is Cc1[nH]c(=S)sc1CC(=O)OCCC1CC1.
What is the InChIKey of 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate?
The InChIKey is RERMFYVTJMLOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S2/c1-7-9(16-11(15)12-7)6-10(13)14-5-4-8-2-3-8/h8H,2-6H2,1H3,(H,12,15).
What are the key properties of 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate?
2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate has a molecular weight of 257.38 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylethyl 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetate is sourced from PubChem (CID 106207980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).