About 2-cyclobutylethyl 4-sulfanylbenzoate
2-cyclobutylethyl 4-sulfanylbenzoate (PubChem CID 106208001) has the molecular formula C13H16O2S
and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-cyclobutylethyl 4-sulfanylbenzoate.
Molecular Properties
| Compound Name | 2-cyclobutylethyl 4-sulfanylbenzoate |
| PubChem CID | 106208001 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-cyclobutylethyl 4-sulfanylbenzoate |
| SMILES | O=C(OCCC1CCC1)c1ccc(S)cc1 |
| InChI | InChI=1S/C13H16O2S/c14-13(11-4-6-12(16)7-5-11)15-9-8-10-2-1-3-10/h4-7,10,16H,1-3,8-9H2 |
| InChIKey | BBQRHXGLWGNFON-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutylethyl 4-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylethyl 4-sulfanylbenzoate?
The IUPAC name of 2-cyclobutylethyl 4-sulfanylbenzoate (CID 106208001) is 2-cyclobutylethyl 4-sulfanylbenzoate.
What is the SMILES notation for 2-cyclobutylethyl 4-sulfanylbenzoate?
The canonical SMILES for 2-cyclobutylethyl 4-sulfanylbenzoate is O=C(OCCC1CCC1)c1ccc(S)cc1.
What is the InChIKey of 2-cyclobutylethyl 4-sulfanylbenzoate?
The InChIKey is BBQRHXGLWGNFON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2S/c14-13(11-4-6-12(16)7-5-11)15-9-8-10-2-1-3-10/h4-7,10,16H,1-3,8-9H2.
What are the key properties of 2-cyclobutylethyl 4-sulfanylbenzoate?
2-cyclobutylethyl 4-sulfanylbenzoate has a molecular weight of 236.34 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylethyl 4-sulfanylbenzoate is sourced from PubChem (CID 106208001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).