C22H27N3O2S — CID 10620836
(3R,6S)-6-(cyclohexylmethyl)-1-(quinolin-2-ylmethyl)-3-(sulfanylmethyl)piperazine-2,5-dione (PubChem CID 10620836) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is (3R,6S)-6-(cyclohexylmethyl)-1-(quinolin-2-ylmethyl)-3-(sulfanylmethyl)piperazine-2,5-dione.
| Compound Name | (3R,6S)-6-(cyclohexylmethyl)-1-(quinolin-2-ylmethyl)-3-(sulfanylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 10620836 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (3R,6S)-6-(cyclohexylmethyl)-1-(quinolin-2-ylmethyl)-3-(sulfanylmethyl)piperazine-2,5-dione |
| SMILES | O=C1N[C@@H](CS)C(=O)N(Cc2ccc3ccccc3n2)[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C22H27N3O2S/c26-21-20(12-15-6-2-1-3-7-15)25(22(27)19(14-28)24-21)13-17-11-10-16-8-4-5-9-18(16)23-17/h4-5,8-11,15,19-20,28H,1-3,6-7,12-14H2,(H,24,26)/t19-,20-/m0/s1 |
| InChIKey | SKDNVHHXHPMJHN-PMACEKPBSA-N |
| XLogP | 3.33 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|