C15H17N3O3 — CID 106208660
3,6-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylcarbamoyl]benzoic acid (PubChem CID 106208660) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3,6-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylcarbamoyl]benzoic acid.
| Compound Name | 3,6-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 106208660 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3,6-dimethyl-2-[1-(1H-pyrazol-4-yl)ethylcarbamoyl]benzoic acid |
| SMILES | Cc1ccc(C)c(C(=O)NC(C)c2cn[nH]c2)c1C(=O)O |
| InChI | InChI=1S/C15H17N3O3/c1-8-4-5-9(2)13(15(20)21)12(8)14(19)18-10(3)11-6-16-17-7-11/h4-7,10H,1-3H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | KBIAGAACNPCBIO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |