About 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine
6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine (PubChem CID 106208717) has the molecular formula C12H12F3N
and a molecular weight of 227.23 g/mol. Its IUPAC name is 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine.
Molecular Properties
| Compound Name | 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine |
| PubChem CID | 106208717 |
| Molecular Formula | C12H12F3N |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine |
| SMILES | NCCCCC#Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H12F3N/c13-10-7-6-9(11(14)12(10)15)5-3-1-2-4-8-16/h6-7H,1-2,4,8,16H2 |
| InChIKey | RRKHHIGFYPXOQN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine?
The IUPAC name of 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine (CID 106208717) is 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine.
What is the SMILES notation for 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine?
The canonical SMILES for 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine is NCCCCC#Cc1ccc(F)c(F)c1F.
What is the InChIKey of 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine?
The InChIKey is RRKHHIGFYPXOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3N/c13-10-7-6-9(11(14)12(10)15)5-3-1-2-4-8-16/h6-7H,1-2,4,8,16H2.
What are the key properties of 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine?
6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine has a molecular weight of 227.23 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3,4-trifluorophenyl)hex-5-yn-1-amine is sourced from PubChem (CID 106208717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).