C13H25N5O — CID 106209360
2-[4-(4-aminobutyl)triazol-1-yl]-N-butylpropanamide (PubChem CID 106209360) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-[4-(4-aminobutyl)triazol-1-yl]-N-butylpropanamide.
| Compound Name | 2-[4-(4-aminobutyl)triazol-1-yl]-N-butylpropanamide |
|---|---|
| PubChem CID | 106209360 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 2-[4-(4-aminobutyl)triazol-1-yl]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)n1cc(CCCCN)nn1 |
| InChI | InChI=1S/C13H25N5O/c1-3-4-9-15-13(19)11(2)18-10-12(16-17-18)7-5-6-8-14/h10-11H,3-9,14H2,1-2H3,(H,15,19) |
| InChIKey | WHUDDPXWVQEDOZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|