C15H16N4 — CID 106209528
N-(isoquinolin-5-ylmethyl)-1-(1H-pyrazol-4-yl)ethanamine (PubChem CID 106209528) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is N-(isoquinolin-5-ylmethyl)-1-(1H-pyrazol-4-yl)ethanamine.
| Compound Name | N-(isoquinolin-5-ylmethyl)-1-(1H-pyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 106209528 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-(isoquinolin-5-ylmethyl)-1-(1H-pyrazol-4-yl)ethanamine |
| SMILES | CC(NCc1cccc2cnccc12)c1cn[nH]c1 |
| InChI | InChI=1S/C15H16N4/c1-11(14-9-18-19-10-14)17-8-13-4-2-3-12-7-16-6-5-15(12)13/h2-7,9-11,17H,8H2,1H3,(H,18,19) |
| InChIKey | HXRTXLNREOODIM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |