C18H10F6N2O2 — CID 10620978
N,5-bis[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide (PubChem CID 10620978) has the molecular formula C18H10F6N2O2 and a molecular weight of 400.28 g/mol. Its IUPAC name is N,5-bis[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide.
| Compound Name | N,5-bis[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 10620978 |
| Molecular Formula | C18H10F6N2O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N,5-bis[4-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cnoc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H10F6N2O2/c19-17(20,21)11-3-1-10(2-4-11)15-14(9-25-28-15)16(27)26-13-7-5-12(6-8-13)18(22,23)24/h1-9H,(H,26,27) |
| InChIKey | VOEVTPPPHKVAII-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |