C19H36N4O5 — CID 10621015
(2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-morpholin-4-ylbutanediamide (PubChem CID 10621015) has the molecular formula C19H36N4O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-morpholin-4-ylbutanediamide.
| Compound Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-morpholin-4-ylbutanediamide |
|---|---|
| PubChem CID | 10621015 |
| Molecular Formula | C19H36N4O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-morpholin-4-ylbutanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@@H](C(=O)NO)N1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C19H36N4O5/c1-12(2)11-13(14(17(25)22-27)23-7-9-28-10-8-23)16(24)21-15(18(26)20-6)19(3,4)5/h12-15,27H,7-11H2,1-6H3,(H,20,26)(H,21,24)(H,22,25)/t13-,14+,15-/m1/s1 |
| InChIKey | FTWOUUKMIDBQOJ-QLFBSQMISA-N |
| XLogP | 0.13 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|