C24H28N6 — CID 10621021
3-[3-(4-benzylpiperazin-1-yl)propyl]-5-(1,2,4-triazol-4-yl)-1H-indole (PubChem CID 10621021) has the molecular formula C24H28N6 and a molecular weight of 400.53 g/mol. Its IUPAC name is 3-[3-(4-benzylpiperazin-1-yl)propyl]-5-(1,2,4-triazol-4-yl)-1H-indole.
| Compound Name | 3-[3-(4-benzylpiperazin-1-yl)propyl]-5-(1,2,4-triazol-4-yl)-1H-indole |
|---|---|
| PubChem CID | 10621021 |
| Molecular Formula | C24H28N6 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 3-[3-(4-benzylpiperazin-1-yl)propyl]-5-(1,2,4-triazol-4-yl)-1H-indole |
| SMILES | c1ccc(CN2CCN(CCCc3c[nH]c4ccc(-n5cnnc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C24H28N6/c1-2-5-20(6-3-1)17-29-13-11-28(12-14-29)10-4-7-21-16-25-24-9-8-22(15-23(21)24)30-18-26-27-19-30/h1-3,5-6,8-9,15-16,18-19,25H,4,7,10-14,17H2 |
| InChIKey | PPQXZSWFDQGWBH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |