C8H6F3NO2 — CID 106210532
1-[1-(trifluoromethyl)cyclopropyl]pyrrole-2,5-dione (PubChem CID 106210532) has the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. Its IUPAC name is 1-[1-(trifluoromethyl)cyclopropyl]pyrrole-2,5-dione.
| Compound Name | 1-[1-(trifluoromethyl)cyclopropyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 106210532 |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 1-[1-(trifluoromethyl)cyclopropyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H6F3NO2/c9-8(10,11)7(3-4-7)12-5(13)1-2-6(12)14/h1-2H,3-4H2 |
| InChIKey | ALIPEXJEEFPGEF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|