C9H9BrF3NO — CID 106210704
N-[(3-bromofuran-2-yl)methyl]-1-(trifluoromethyl)cyclopropan-1-amine (PubChem CID 106210704) has the molecular formula C9H9BrF3NO and a molecular weight of 284.07 g/mol. Its IUPAC name is N-[(3-bromofuran-2-yl)methyl]-1-(trifluoromethyl)cyclopropan-1-amine.
| Compound Name | N-[(3-bromofuran-2-yl)methyl]-1-(trifluoromethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 106210704 |
| Molecular Formula | C9H9BrF3NO |
| Molecular Weight | 284.07 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | N-[(3-bromofuran-2-yl)methyl]-1-(trifluoromethyl)cyclopropan-1-amine |
| SMILES | FC(F)(F)C1(NCc2occc2Br)CC1 |
| InChI | InChI=1S/C9H9BrF3NO/c10-6-1-4-15-7(6)5-14-8(2-3-8)9(11,12)13/h1,4,14H,2-3,5H2 |
| InChIKey | GPATUKHVSHIXHM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.07 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |