About 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione
9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 106210771) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione.
Molecular Properties
| Compound Name | 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| PubChem CID | 106210771 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | C#CCCCCN1C(=O)C2(CCCC2)NC(=O)C1C |
| InChI | InChI=1S/C15H22N2O2/c1-3-4-5-8-11-17-12(2)13(18)16-15(14(17)19)9-6-7-10-15/h1,12H,4-11H2,2H3,(H,16,18) |
| InChIKey | HCOROLIATHGYPB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione?
The IUPAC name of 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione (CID 106210771) is 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione.
What is the SMILES notation for 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione?
The canonical SMILES for 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione is C#CCCCCN1C(=O)C2(CCCC2)NC(=O)C1C.
What is the InChIKey of 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione?
The InChIKey is HCOROLIATHGYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-3-4-5-8-11-17-12(2)13(18)16-15(14(17)19)9-6-7-10-15/h1,12H,4-11H2,2H3,(H,16,18).
What are the key properties of 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione?
9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione has a molecular weight of 262.35 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hex-5-ynyl-8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione is sourced from PubChem (CID 106210771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).