C16H20N2O — CID 106211618
3-(hex-5-ynylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 106211618) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(hex-5-ynylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-(hex-5-ynylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 106211618 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-(hex-5-ynylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | C#CCCCCNC1CCc2ccccc2NC1=O |
| InChI | InChI=1S/C16H20N2O/c1-2-3-4-7-12-17-15-11-10-13-8-5-6-9-14(13)18-16(15)19/h1,5-6,8-9,15,17H,3-4,7,10-12H2,(H,18,19) |
| InChIKey | KYGLWBJDIYKDFE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|